"کیفین" کے نسخوں کے درمیان فرق

حذف شدہ مندرجات اضافہ شدہ مندرجات
م bot: removed {{Link GA}}, it is now given by wikidata
م clean up, replaced: ← (30) using AWB
سطر 1:
{{Chembox new
| Name = کیفین
| ImageFile = Caffeine.svg
| ImageSize = 175px
| ImageName = Caffeine
| ImageFile1 = Caffeine-3D-QuteMol.png
| ImageSize1 = 135px
| ImageName1 = Caffeine
| IUPACName = 1,3,7-trimethyl-1''H''-purine-2,6(3''H'',7''H'')-dione
| OtherNames = 1,3,7-trimethylxanthine, trimethylxanthine,<br /> theine, methyltheobromine
| Section1 = {{Chembox Identifiers
| SMILES = C[n]1cnc2N(C)C(=O)N(C)C(=O)c12
| CASNo = 58-08-2
| RTECS = EV6475000
}}
| Section2 = {{Chembox Properties
| Formula = [[carbon|C]]<sub>8</sub>[[آبساز|H]]<sub>10</sub>[[نطرساز|N]]<sub>4</sub>[[oxygen|O]]<sub>2</sub>
| MolarMass = 194.19&nbsp;g·mol<sup>&minus;1</sup>
| Appearance = Odorless, white needles or powder
| Density = 1.2&nbsp;g·cm<sup>&minus;3</sup>, solid
| Solubility = 22 mg·mL<sup>&minus;1</sup> (25&nbsp;°C)<br />180 mg·mL<sup>&minus;1</sup> (80&nbsp;°C)<br />670 mg·mL<sup>&minus;1</sup> (100&nbsp;°C)
| MeltingPt = 237&nbsp;°C (non-equilibrium, superheated)
| BoilingPt = 178&nbsp;°C ([[sublimation (chemistry)|sublimes]])
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.sciencestuff.com/msds/C1410.html External MSDS]
| MainHazards = May be fatal if inhaled, swallowed<br />or absorbed through the skin.
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R =
| FlashPt = N/A
| LD50 = 192 mg/kg (rat, oral)<ref name=ld50/>}}
}}